D06.
Distinguish between condensation and addition polymerization based on the
composition change and the requisites of polymerization.
Condensation
polymerization
This
polymerization process is a special case of the step-growth polymerization.
During a condensation process, a condensation product is formed. This
condensation product can be water, but also other condensation products such as
different alcohols may form.
The
simplified reaction can be written as a condensation reaction between a diol and
a dibasic acid:
HO-R-OH
+
HO-C(O)-Q-C(O)-OH => HO-R-O-C(O)-Q-C(O)-OH + H2O
R and Q represent different central structures.
Examples
In
dentistry, we use two impression materials that set via condensation reactions.
One of these materials is the polysulfide impression material that produces
water when it sets (D05). The other impression material is the
condensation-polymerized silicone (c-silicone) that produces ethanol when it
sets. Because these condensation products can evaporate from the above
impression materials, these two impression materials are known to shrink over
time. The larger ethanol molecule as well as its tendency to evaporate faster
than water explains why c-silicones shrink faster and more than the polysulfides
over time.
This
reaction shows a step growth reaction during which a diol reacts with an
isocyanate group to form a urethane. As seen from this slide, no condensation
product is formed despite the similarities with the reaction shown on the
previous slide. Because of the similarities between the two reactions, both can
be called step-growth polymerization reactions, while only the reaction shown in
the previous slide can be called a condensation polymerization reaction.
Addition
polymerization
To
overcome the above problems with condensation products that evaporate and cause
shrinkage over time, manufacturers of silicone impression materials have now
developed so called polyvinylsiloxane impression materials. These materials
contain carbon double bonds (vinyl groups) that during polymerization open up
and link the monomer units together via an addition polymerization reaction,
which explains why these silicones are called a-silicones. During the setting
reaction, no by-product is formed, explaining why these materials retain their
dimensional stability over time after they have set.
The
simplified reaction can be described as:
I*+ C(H2)=C(H2) => I-C(H2)-C(H2)*
I-C(H2)-C(H2)* + C(H2)=C(H2) => I-C(H2)-C(H2)-C(H2)-C(H2)*
I-C(H2)-C(H2)-C(H2)-C(H2)* + C(H2)=C(H2) => I-C(H2)-C(H2)-C(H2)-C(H2)-C(H2)-C(H2)* and so on....
I*
represents a free radical